C22H17NO5S — CID 4899910
N-(4-methoxyphenyl)-2-[[3-oxo-2-(thiophen-2-ylmethylidene)-1-benzofuran-6-yl]oxy]acetamide (PubChem CID 4899910) has the molecular formula C22H17NO5S and a molecular weight of 407.45 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[[3-oxo-2-(thiophen-2-ylmethylidene)-1-benzofuran-6-yl]oxy]acetamide.
| Compound Name | N-(4-methoxyphenyl)-2-[[3-oxo-2-(thiophen-2-ylmethylidene)-1-benzofuran-6-yl]oxy]acetamide |
|---|---|
| PubChem CID | 4899910 |
| Molecular Formula | C22H17NO5S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[[3-oxo-2-(thiophen-2-ylmethylidene)-1-benzofuran-6-yl]oxy]acetamide |
| SMILES | COc1ccc(NC(=O)COc2ccc3c(c2)OC(=Cc2cccs2)C3=O)cc1 |
| InChI | InChI=1S/C22H17NO5S/c1-26-15-6-4-14(5-7-15)23-21(24)13-27-16-8-9-18-19(11-16)28-20(22(18)25)12-17-3-2-10-29-17/h2-12H,13H2,1H3,(H,23,24) |
| InChIKey | GDZKYCGJQNJBGD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|