C23H17NO6S — CID 92946923
(2S)-2-[[2-[[(2Z)-3-oxo-2-(thiophen-2-ylmethylidene)-1-benzofuran-6-yl]oxy]acetyl]amino]-2-phenylacetic acid (PubChem CID 92946923) has the molecular formula C23H17NO6S and a molecular weight of 435.46 g/mol. Its IUPAC name is (2S)-2-[[2-[[(2Z)-3-oxo-2-(thiophen-2-ylmethylidene)-1-benzofuran-6-yl]oxy]acetyl]amino]-2-phenylacetic acid.
| Compound Name | (2S)-2-[[2-[[(2Z)-3-oxo-2-(thiophen-2-ylmethylidene)-1-benzofuran-6-yl]oxy]acetyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 92946923 |
| Molecular Formula | C23H17NO6S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | (2S)-2-[[2-[[(2Z)-3-oxo-2-(thiophen-2-ylmethylidene)-1-benzofuran-6-yl]oxy]acetyl]amino]-2-phenylacetic acid |
| SMILES | O=C(COc1ccc2c(c1)O/C(=C\c1cccs1)C2=O)N[C@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C23H17NO6S/c25-20(24-21(23(27)28)14-5-2-1-3-6-14)13-29-15-8-9-17-18(11-15)30-19(22(17)26)12-16-7-4-10-31-16/h1-12,21H,13H2,(H,24,25)(H,27,28)/b19-12-/t21-/m0/s1 |
| InChIKey | MKOMZJSNBAUGTQ-JCAJYURWSA-N |
| XLogP | 3.69 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|