C28H25NO9 — CID 73399781
2-[[2-[[3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetyl]amino]-2-phenylacetic acid (PubChem CID 73399781) has the molecular formula C28H25NO9 and a molecular weight of 519.51 g/mol. Its IUPAC name is 2-[[2-[[3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetyl]amino]-2-phenylacetic acid.
| Compound Name | 2-[[2-[[3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 73399781 |
| Molecular Formula | C28H25NO9 |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | 2-[[2-[[3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetyl]amino]-2-phenylacetic acid |
| SMILES | COc1ccc(C=C2Oc3cc(OCC(=O)NC(C(=O)O)c4ccccc4)ccc3C2=O)c(OC)c1OC |
| InChI | InChI=1S/C28H25NO9/c1-34-20-12-9-17(26(35-2)27(20)36-3)13-22-25(31)19-11-10-18(14-21(19)38-22)37-15-23(30)29-24(28(32)33)16-7-5-4-6-8-16/h4-14,24H,15H2,1-3H3,(H,29,30)(H,32,33) |
| InChIKey | DRLXJRPHEIHKBI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|