C24H25NO9 — CID 4964979
4-[[2-[[3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetyl]amino]butanoic acid (PubChem CID 4964979) has the molecular formula C24H25NO9 and a molecular weight of 471.46 g/mol. Its IUPAC name is 4-[[2-[[3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetyl]amino]butanoic acid.
| Compound Name | 4-[[2-[[3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 4964979 |
| Molecular Formula | C24H25NO9 |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 4-[[2-[[3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetyl]amino]butanoic acid |
| SMILES | COc1ccc(C=C2Oc3cc(OCC(=O)NCCCC(=O)O)ccc3C2=O)c(OC)c1OC |
| InChI | InChI=1S/C24H25NO9/c1-30-17-9-6-14(23(31-2)24(17)32-3)11-19-22(29)16-8-7-15(12-18(16)34-19)33-13-20(26)25-10-4-5-21(27)28/h6-9,11-12H,4-5,10,13H2,1-3H3,(H,25,26)(H,27,28) |
| InChIKey | WTPOTUSQDKMHBK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|