C20H18O8 — CID 110207484
2-[[(2E)-3-oxo-2-[(2,3,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetic acid (PubChem CID 110207484) has the molecular formula C20H18O8 and a molecular weight of 386.36 g/mol. Its IUPAC name is 2-[[(2E)-3-oxo-2-[(2,3,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetic acid.
| Compound Name | 2-[[(2E)-3-oxo-2-[(2,3,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 110207484 |
| Molecular Formula | C20H18O8 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 2-[[(2E)-3-oxo-2-[(2,3,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetic acid |
| SMILES | COc1cc(/C=C2/Oc3cc(OCC(=O)O)ccc3C2=O)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H18O8/c1-24-13-6-11(20(26-3)17(9-13)25-2)7-16-19(23)14-5-4-12(8-15(14)28-16)27-10-18(21)22/h4-9H,10H2,1-3H3,(H,21,22)/b16-7+ |
| InChIKey | GAIWUVGTCJLGTK-FRKPEAEDSA-N |
| XLogP | 2.79 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|