C20H19NO7 — CID 162857760
2-[[3-oxo-2-[(2,3,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetamide (PubChem CID 162857760) has the molecular formula C20H19NO7 and a molecular weight of 385.37 g/mol. Its IUPAC name is 2-[[3-oxo-2-[(2,3,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetamide.
| Compound Name | 2-[[3-oxo-2-[(2,3,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetamide |
|---|---|
| PubChem CID | 162857760 |
| Molecular Formula | C20H19NO7 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 2-[[3-oxo-2-[(2,3,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetamide |
| SMILES | COc1cc(C=C2Oc3cc(OCC(N)=O)ccc3C2=O)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H19NO7/c1-24-13-6-11(20(26-3)17(9-13)25-2)7-16-19(23)14-5-4-12(8-15(14)28-16)27-10-18(21)22/h4-9H,10H2,1-3H3,(H2,21,22) |
| InChIKey | GQLUYGGIQZOGRK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|