C24H20N2O6 — CID 4906118
2-[[2-[(2,3-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]-N-pyridin-2-ylacetamide (PubChem CID 4906118) has the molecular formula C24H20N2O6 and a molecular weight of 432.43 g/mol. Its IUPAC name is 2-[[2-[(2,3-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]-N-pyridin-2-ylacetamide.
| Compound Name | 2-[[2-[(2,3-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]-N-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 4906118 |
| Molecular Formula | C24H20N2O6 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 2-[[2-[(2,3-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]-N-pyridin-2-ylacetamide |
| SMILES | COc1cccc(C=C2Oc3cc(OCC(=O)Nc4ccccn4)ccc3C2=O)c1OC |
| InChI | InChI=1S/C24H20N2O6/c1-29-18-7-5-6-15(24(18)30-2)12-20-23(28)17-10-9-16(13-19(17)32-20)31-14-22(27)26-21-8-3-4-11-25-21/h3-13H,14H2,1-2H3,(H,25,26,27) |
| InChIKey | ZYZYBDAVCZNURO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|