C25H27NO6 — CID 4870091
2-[(2,3-dimethoxyphenyl)methylidene]-6-[2-(4-methylpiperidin-1-yl)-2-oxoethoxy]-1-benzofuran-3-one (PubChem CID 4870091) has the molecular formula C25H27NO6 and a molecular weight of 437.49 g/mol. Its IUPAC name is 2-[(2,3-dimethoxyphenyl)methylidene]-6-[2-(4-methylpiperidin-1-yl)-2-oxoethoxy]-1-benzofuran-3-one.
| Compound Name | 2-[(2,3-dimethoxyphenyl)methylidene]-6-[2-(4-methylpiperidin-1-yl)-2-oxoethoxy]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 4870091 |
| Molecular Formula | C25H27NO6 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 2-[(2,3-dimethoxyphenyl)methylidene]-6-[2-(4-methylpiperidin-1-yl)-2-oxoethoxy]-1-benzofuran-3-one |
| SMILES | COc1cccc(C=C2Oc3cc(OCC(=O)N4CCC(C)CC4)ccc3C2=O)c1OC |
| InChI | InChI=1S/C25H27NO6/c1-16-9-11-26(12-10-16)23(27)15-31-18-7-8-19-21(14-18)32-22(24(19)28)13-17-5-4-6-20(29-2)25(17)30-3/h4-8,13-14,16H,9-12,15H2,1-3H3 |
| InChIKey | QTIGLPPANRQQIT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|