C27H29NO8 — CID 4912099
ethyl 1-[2-[[2-[(3,4-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]piperidine-4-carboxylate (PubChem CID 4912099) has the molecular formula C27H29NO8 and a molecular weight of 495.53 g/mol. Its IUPAC name is ethyl 1-[2-[[2-[(3,4-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[[2-[(3,4-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 4912099 |
| Molecular Formula | C27H29NO8 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | ethyl 1-[2-[[2-[(3,4-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)COc2ccc3c(c2)OC(=Cc2ccc(OC)c(OC)c2)C3=O)CC1 |
| InChI | InChI=1S/C27H29NO8/c1-4-34-27(31)18-9-11-28(12-10-18)25(29)16-35-19-6-7-20-22(15-19)36-24(26(20)30)14-17-5-8-21(32-2)23(13-17)33-3/h5-8,13-15,18H,4,9-12,16H2,1-3H3 |
| InChIKey | INNYNGIELGRJQD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|