C25H30ClNO5 — CID 118723619
(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-6-(3-piperidin-1-ylpropoxy)-1-benzofuran-3-one;hydrochloride (PubChem CID 118723619) has the molecular formula C25H30ClNO5 and a molecular weight of 459.97 g/mol. Its IUPAC name is (2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-6-(3-piperidin-1-ylpropoxy)-1-benzofuran-3-one;hydrochloride.
| Compound Name | (2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-6-(3-piperidin-1-ylpropoxy)-1-benzofuran-3-one;hydrochloride |
|---|---|
| PubChem CID | 118723619 |
| Molecular Formula | C25H30ClNO5 |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | (2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-6-(3-piperidin-1-ylpropoxy)-1-benzofuran-3-one;hydrochloride |
| SMILES | COc1ccc(/C=C2\Oc3cc(OCCCN4CCCCC4)ccc3C2=O)cc1OC.Cl |
| InChI | InChI=1S/C25H29NO5.ClH/c1-28-21-10-7-18(15-23(21)29-2)16-24-25(27)20-9-8-19(17-22(20)31-24)30-14-6-13-26-11-4-3-5-12-26;/h7-10,15-17H,3-6,11-14H2,1-2H3;1H/b24-16-; |
| InChIKey | OJTONGJPPNIKAI-PNNXLEGYSA-N |
| XLogP | 5.00 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|