C23H25NO4 — CID 118723602
(2Z)-2-[(3-methoxyphenyl)methylidene]-6-(3-pyrrolidin-1-ylpropoxy)-1-benzofuran-3-one (PubChem CID 118723602) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is (2Z)-2-[(3-methoxyphenyl)methylidene]-6-(3-pyrrolidin-1-ylpropoxy)-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(3-methoxyphenyl)methylidene]-6-(3-pyrrolidin-1-ylpropoxy)-1-benzofuran-3-one |
|---|---|
| PubChem CID | 118723602 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | (2Z)-2-[(3-methoxyphenyl)methylidene]-6-(3-pyrrolidin-1-ylpropoxy)-1-benzofuran-3-one |
| SMILES | COc1cccc(/C=C2\Oc3cc(OCCCN4CCCC4)ccc3C2=O)c1 |
| InChI | InChI=1S/C23H25NO4/c1-26-18-7-4-6-17(14-18)15-22-23(25)20-9-8-19(16-21(20)28-22)27-13-5-12-24-10-2-3-11-24/h4,6-9,14-16H,2-3,5,10-13H2,1H3/b22-15- |
| InChIKey | FZVBGYHBXNPINC-JCMHNJIXSA-N |
| XLogP | 4.18 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|