C20H16O5 — CID 941262
[(2E)-2-[(3-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] cyclopropanecarboxylate (PubChem CID 941262) has the molecular formula C20H16O5 and a molecular weight of 336.34 g/mol. Its IUPAC name is [(2E)-2-[(3-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] cyclopropanecarboxylate.
| Compound Name | [(2E)-2-[(3-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 941262 |
| Molecular Formula | C20H16O5 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | [(2E)-2-[(3-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] cyclopropanecarboxylate |
| SMILES | COc1cccc(/C=C2/Oc3cc(OC(=O)C4CC4)ccc3C2=O)c1 |
| InChI | InChI=1S/C20H16O5/c1-23-14-4-2-3-12(9-14)10-18-19(21)16-8-7-15(11-17(16)25-18)24-20(22)13-5-6-13/h2-4,7-11,13H,5-6H2,1H3/b18-10+ |
| InChIKey | KAJBBSYNJBADOW-VCHYOVAHSA-N |
| XLogP | 3.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|