C19H13BrO4 — CID 2031575
[(2E)-2-[(4-bromophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] cyclopropanecarboxylate (PubChem CID 2031575) has the molecular formula C19H13BrO4 and a molecular weight of 385.21 g/mol. Its IUPAC name is [(2E)-2-[(4-bromophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] cyclopropanecarboxylate.
| Compound Name | [(2E)-2-[(4-bromophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 2031575 |
| Molecular Formula | C19H13BrO4 |
| Molecular Weight | 385.21 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | [(2E)-2-[(4-bromophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] cyclopropanecarboxylate |
| SMILES | O=C1/C(=C\c2ccc(Br)cc2)Oc2cc(OC(=O)C3CC3)ccc21 |
| InChI | InChI=1S/C19H13BrO4/c20-13-5-1-11(2-6-13)9-17-18(21)15-8-7-14(10-16(15)24-17)23-19(22)12-3-4-12/h1-2,5-10,12H,3-4H2/b17-9+ |
| InChIKey | VDBLWMXWVYNEBA-RQZCQDPDSA-N |
| XLogP | 4.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.21 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|