C22H19ClO4 — CID 5264752
[2-[(2-chlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] cyclohexanecarboxylate (PubChem CID 5264752) has the molecular formula C22H19ClO4 and a molecular weight of 382.84 g/mol. Its IUPAC name is [2-[(2-chlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] cyclohexanecarboxylate.
| Compound Name | [2-[(2-chlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 5264752 |
| Molecular Formula | C22H19ClO4 |
| Molecular Weight | 382.84 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | [2-[(2-chlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] cyclohexanecarboxylate |
| SMILES | O=C1C(=Cc2ccccc2Cl)Oc2cc(OC(=O)C3CCCCC3)ccc21 |
| InChI | InChI=1S/C22H19ClO4/c23-18-9-5-4-8-15(18)12-20-21(24)17-11-10-16(13-19(17)27-20)26-22(25)14-6-2-1-3-7-14/h4-5,8-14H,1-3,6-7H2 |
| InChIKey | WCOGBCQSVQQTAP-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.84 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|