C26H27NO7 — CID 4975293
ethyl 1-[2-[[2-[(3-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]piperidine-4-carboxylate (PubChem CID 4975293) has the molecular formula C26H27NO7 and a molecular weight of 465.50 g/mol. Its IUPAC name is ethyl 1-[2-[[2-[(3-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[[2-[(3-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 4975293 |
| Molecular Formula | C26H27NO7 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | ethyl 1-[2-[[2-[(3-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)COc2ccc3c(c2)OC(=Cc2cccc(OC)c2)C3=O)CC1 |
| InChI | InChI=1S/C26H27NO7/c1-3-32-26(30)18-9-11-27(12-10-18)24(28)16-33-20-7-8-21-22(15-20)34-23(25(21)29)14-17-5-4-6-19(13-17)31-2/h4-8,13-15,18H,3,9-12,16H2,1-2H3 |
| InChIKey | NROQIIIXNXLPJN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|