C23H23NO6S — CID 4912471
ethyl 1-[2-[[3-oxo-2-(thiophen-2-ylmethylidene)-1-benzofuran-6-yl]oxy]acetyl]piperidine-3-carboxylate (PubChem CID 4912471) has the molecular formula C23H23NO6S and a molecular weight of 441.51 g/mol. Its IUPAC name is ethyl 1-[2-[[3-oxo-2-(thiophen-2-ylmethylidene)-1-benzofuran-6-yl]oxy]acetyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-[[3-oxo-2-(thiophen-2-ylmethylidene)-1-benzofuran-6-yl]oxy]acetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 4912471 |
| Molecular Formula | C23H23NO6S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | ethyl 1-[2-[[3-oxo-2-(thiophen-2-ylmethylidene)-1-benzofuran-6-yl]oxy]acetyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)COc2ccc3c(c2)OC(=Cc2cccs2)C3=O)C1 |
| InChI | InChI=1S/C23H23NO6S/c1-2-28-23(27)15-5-3-9-24(13-15)21(25)14-29-16-7-8-18-19(11-16)30-20(22(18)26)12-17-6-4-10-31-17/h4,6-8,10-12,15H,2-3,5,9,13-14H2,1H3 |
| InChIKey | BCVOOGNWCWUOPG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|