C18H15NO7S — CID 4976476
3-hydroxy-2-[[2-[[3-oxo-2-(thiophen-2-ylmethylidene)-1-benzofuran-6-yl]oxy]acetyl]amino]propanoic acid (PubChem CID 4976476) has the molecular formula C18H15NO7S and a molecular weight of 389.39 g/mol. Its IUPAC name is 3-hydroxy-2-[[2-[[3-oxo-2-(thiophen-2-ylmethylidene)-1-benzofuran-6-yl]oxy]acetyl]amino]propanoic acid.
| Compound Name | 3-hydroxy-2-[[2-[[3-oxo-2-(thiophen-2-ylmethylidene)-1-benzofuran-6-yl]oxy]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 4976476 |
| Molecular Formula | C18H15NO7S |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 3-hydroxy-2-[[2-[[3-oxo-2-(thiophen-2-ylmethylidene)-1-benzofuran-6-yl]oxy]acetyl]amino]propanoic acid |
| SMILES | O=C(COc1ccc2c(c1)OC(=Cc1cccs1)C2=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C18H15NO7S/c20-8-13(18(23)24)19-16(21)9-25-10-3-4-12-14(6-10)26-15(17(12)22)7-11-2-1-5-27-11/h1-7,13,20H,8-9H2,(H,19,21)(H,23,24) |
| InChIKey | BJMYCMVUXUQPAF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|