C27H23NO7 — CID 163006294
(2R)-2-[[2-[[2-[(4-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]-3-phenylpropanoic acid (PubChem CID 163006294) has the molecular formula C27H23NO7 and a molecular weight of 473.48 g/mol. Its IUPAC name is (2R)-2-[[2-[[2-[(4-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[2-[[2-[(4-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 163006294 |
| Molecular Formula | C27H23NO7 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | (2R)-2-[[2-[[2-[(4-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]-3-phenylpropanoic acid |
| SMILES | COc1ccc(C=C2Oc3cc(OCC(=O)N[C@H](Cc4ccccc4)C(=O)O)ccc3C2=O)cc1 |
| InChI | InChI=1S/C27H23NO7/c1-33-19-9-7-18(8-10-19)14-24-26(30)21-12-11-20(15-23(21)35-24)34-16-25(29)28-22(27(31)32)13-17-5-3-2-4-6-17/h2-12,14-15,22H,13,16H2,1H3,(H,28,29)(H,31,32)/t22-/m1/s1 |
| InChIKey | NCQYQQCGSLKVKP-JOCHJYFZSA-N |
| XLogP | 3.50 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|