C22H21NO8 — CID 163062180
(2R,3S)-3-hydroxy-2-[[2-[[2-[(3-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]butanoic acid (PubChem CID 163062180) has the molecular formula C22H21NO8 and a molecular weight of 427.41 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-2-[[2-[[2-[(3-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]butanoic acid.
| Compound Name | (2R,3S)-3-hydroxy-2-[[2-[[2-[(3-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 163062180 |
| Molecular Formula | C22H21NO8 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | (2R,3S)-3-hydroxy-2-[[2-[[2-[(3-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]butanoic acid |
| SMILES | COc1cccc(C=C2Oc3cc(OCC(=O)N[C@@H](C(=O)O)[C@H](C)O)ccc3C2=O)c1 |
| InChI | InChI=1S/C22H21NO8/c1-12(24)20(22(27)28)23-19(25)11-30-15-6-7-16-17(10-15)31-18(21(16)26)9-13-4-3-5-14(8-13)29-2/h3-10,12,20,24H,11H2,1-2H3,(H,23,25)(H,27,28)/t12-,20+/m0/s1 |
| InChIKey | XQULUMHMUYSFDM-FKIZINRSSA-N |
| XLogP | 1.64 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|