C27H23NO8 — CID 71964375
(2R)-2-[[2-[[2-[(3,4-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]-2-phenylacetic acid (PubChem CID 71964375) has the molecular formula C27H23NO8 and a molecular weight of 489.48 g/mol. Its IUPAC name is (2R)-2-[[2-[[2-[(3,4-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]-2-phenylacetic acid.
| Compound Name | (2R)-2-[[2-[[2-[(3,4-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 71964375 |
| Molecular Formula | C27H23NO8 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | (2R)-2-[[2-[[2-[(3,4-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]-2-phenylacetic acid |
| SMILES | COc1ccc(C=C2Oc3cc(OCC(=O)N[C@@H](C(=O)O)c4ccccc4)ccc3C2=O)cc1OC |
| InChI | InChI=1S/C27H23NO8/c1-33-20-11-8-16(12-22(20)34-2)13-23-26(30)19-10-9-18(14-21(19)36-23)35-15-24(29)28-25(27(31)32)17-6-4-3-5-7-17/h3-14,25H,15H2,1-2H3,(H,28,29)(H,31,32)/t25-/m1/s1 |
| InChIKey | UBUVGIQHEXDTPS-RUZDIDTESA-N |
| XLogP | 3.64 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|