C23H25NO8 — CID 73399424
N-(1-hydroxypropan-2-yl)-2-[[3-oxo-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetamide (PubChem CID 73399424) has the molecular formula C23H25NO8 and a molecular weight of 443.45 g/mol. Its IUPAC name is N-(1-hydroxypropan-2-yl)-2-[[3-oxo-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetamide.
| Compound Name | N-(1-hydroxypropan-2-yl)-2-[[3-oxo-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetamide |
|---|---|
| PubChem CID | 73399424 |
| Molecular Formula | C23H25NO8 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | N-(1-hydroxypropan-2-yl)-2-[[3-oxo-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetamide |
| SMILES | COc1cc(C=C2Oc3cc(OCC(=O)NC(C)CO)ccc3C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C23H25NO8/c1-13(11-25)24-21(26)12-31-15-5-6-16-17(10-15)32-18(22(16)27)7-14-8-19(28-2)23(30-4)20(9-14)29-3/h5-10,13,25H,11-12H2,1-4H3,(H,24,26) |
| InChIKey | JBNWJKQQRJXENN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|