C23H23NO9 — CID 71963968
(2R)-2-[[2-[[3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetyl]amino]propanoic acid (PubChem CID 71963968) has the molecular formula C23H23NO9 and a molecular weight of 457.44 g/mol. Its IUPAC name is (2R)-2-[[2-[[3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[2-[[3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 71963968 |
| Molecular Formula | C23H23NO9 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | (2R)-2-[[2-[[3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetyl]amino]propanoic acid |
| SMILES | COc1ccc(C=C2Oc3cc(OCC(=O)N[C@H](C)C(=O)O)ccc3C2=O)c(OC)c1OC |
| InChI | InChI=1S/C23H23NO9/c1-12(23(27)28)24-19(25)11-32-14-6-7-15-17(10-14)33-18(20(15)26)9-13-5-8-16(29-2)22(31-4)21(13)30-3/h5-10,12H,11H2,1-4H3,(H,24,25)(H,27,28)/t12-/m1/s1 |
| InChIKey | INAPSRNZRWBOPA-GFCCVEGCSA-N |
| XLogP | 2.30 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|