C23H23NO7 — CID 163081336
(2R)-2-[[2-[[2-[(4-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]-3-methylbutanoic acid (PubChem CID 163081336) has the molecular formula C23H23NO7 and a molecular weight of 425.44 g/mol. Its IUPAC name is (2R)-2-[[2-[[2-[(4-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[2-[[2-[(4-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 163081336 |
| Molecular Formula | C23H23NO7 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | (2R)-2-[[2-[[2-[(4-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]-3-methylbutanoic acid |
| SMILES | COc1ccc(C=C2Oc3cc(OCC(=O)N[C@@H](C(=O)O)C(C)C)ccc3C2=O)cc1 |
| InChI | InChI=1S/C23H23NO7/c1-13(2)21(23(27)28)24-20(25)12-30-16-8-9-17-18(11-16)31-19(22(17)26)10-14-4-6-15(29-3)7-5-14/h4-11,13,21H,12H2,1-3H3,(H,24,25)(H,27,28)/t21-/m1/s1 |
| InChIKey | ONCLHHWNHMTIME-OAQYLSRUSA-N |
| XLogP | 2.92 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|