C22H19NO9 — CID 4967074
2-[[2-[[2-[(2-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]butanedioic acid (PubChem CID 4967074) has the molecular formula C22H19NO9 and a molecular weight of 441.39 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 4967074 |
| Molecular Formula | C22H19NO9 |
| Molecular Weight | 441.39 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 2-[[2-[[2-[(2-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]butanedioic acid |
| SMILES | COc1ccccc1C=C1Oc2cc(OCC(=O)NC(CC(=O)O)C(=O)O)ccc2C1=O |
| InChI | InChI=1S/C22H19NO9/c1-30-16-5-3-2-4-12(16)8-18-21(27)14-7-6-13(9-17(14)32-18)31-11-19(24)23-15(22(28)29)10-20(25)26/h2-9,15H,10-11H2,1H3,(H,23,24)(H,25,26)(H,28,29) |
| InChIKey | UBLNEDILXUFQCQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 148.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|