C20H17NO6S — CID 4912180
1-[2-[[3-oxo-2-(thiophen-2-ylmethylidene)-1-benzofuran-6-yl]oxy]acetyl]pyrrolidine-2-carboxylic acid (PubChem CID 4912180) has the molecular formula C20H17NO6S and a molecular weight of 399.42 g/mol. Its IUPAC name is 1-[2-[[3-oxo-2-(thiophen-2-ylmethylidene)-1-benzofuran-6-yl]oxy]acetyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[3-oxo-2-(thiophen-2-ylmethylidene)-1-benzofuran-6-yl]oxy]acetyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4912180 |
| Molecular Formula | C20H17NO6S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 1-[2-[[3-oxo-2-(thiophen-2-ylmethylidene)-1-benzofuran-6-yl]oxy]acetyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C1C(=Cc2cccs2)Oc2cc(OCC(=O)N3CCCC3C(=O)O)ccc21 |
| InChI | InChI=1S/C20H17NO6S/c22-18(21-7-1-4-15(21)20(24)25)11-26-12-5-6-14-16(9-12)27-17(19(14)23)10-13-3-2-8-28-13/h2-3,5-6,8-10,15H,1,4,7,11H2,(H,24,25) |
| InChIKey | AKMCHJWYWQLTSN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|