C21H15ClFNO8 — CID 4907305
2-[[2-[[2-[(2-chloro-6-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]butanedioic acid (PubChem CID 4907305) has the molecular formula C21H15ClFNO8 and a molecular weight of 463.80 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-chloro-6-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-chloro-6-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 4907305 |
| Molecular Formula | C21H15ClFNO8 |
| Molecular Weight | 463.80 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | 2-[[2-[[2-[(2-chloro-6-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]butanedioic acid |
| SMILES | O=C(O)CC(NC(=O)COc1ccc2c(c1)OC(=Cc1c(F)cccc1Cl)C2=O)C(=O)O |
| InChI | InChI=1S/C21H15ClFNO8/c22-13-2-1-3-14(23)12(13)7-17-20(28)11-5-4-10(6-16(11)32-17)31-9-18(25)24-15(21(29)30)8-19(26)27/h1-7,15H,8-9H2,(H,24,25)(H,26,27)(H,29,30) |
| InChIKey | DTKRKCJDJJLZTK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.80 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|