C23H13BrClFO4 — CID 6317306
(2Z)-6-[2-(4-bromophenyl)-2-oxoethoxy]-2-[(2-chloro-6-fluorophenyl)methylidene]-1-benzofuran-3-one (PubChem CID 6317306) has the molecular formula C23H13BrClFO4 and a molecular weight of 487.71 g/mol. Its IUPAC name is (2Z)-6-[2-(4-bromophenyl)-2-oxoethoxy]-2-[(2-chloro-6-fluorophenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | (2Z)-6-[2-(4-bromophenyl)-2-oxoethoxy]-2-[(2-chloro-6-fluorophenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 6317306 |
| Molecular Formula | C23H13BrClFO4 |
| Molecular Weight | 487.71 g/mol |
| Exact Mass | 485.97 |
| IUPAC Name | (2Z)-6-[2-(4-bromophenyl)-2-oxoethoxy]-2-[(2-chloro-6-fluorophenyl)methylidene]-1-benzofuran-3-one |
| SMILES | O=C(COc1ccc2c(c1)O/C(=C\c1c(F)cccc1Cl)C2=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H13BrClFO4/c24-14-6-4-13(5-7-14)20(27)12-29-15-8-9-16-21(10-15)30-22(23(16)28)11-17-18(25)2-1-3-19(17)26/h1-11H,12H2/b22-11- |
| InChIKey | CLYHRNYCUMRCTM-JJFYIABZSA-N |
| XLogP | 6.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.71 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|