C24H17BrO4 — CID 2014384
(2Z)-6-[2-(4-bromophenyl)-2-oxoethoxy]-2-[(2-methylphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 2014384) has the molecular formula C24H17BrO4 and a molecular weight of 449.30 g/mol. Its IUPAC name is (2Z)-6-[2-(4-bromophenyl)-2-oxoethoxy]-2-[(2-methylphenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | (2Z)-6-[2-(4-bromophenyl)-2-oxoethoxy]-2-[(2-methylphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 2014384 |
| Molecular Formula | C24H17BrO4 |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | (2Z)-6-[2-(4-bromophenyl)-2-oxoethoxy]-2-[(2-methylphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | Cc1ccccc1/C=C1\Oc2cc(OCC(=O)c3ccc(Br)cc3)ccc2C1=O |
| InChI | InChI=1S/C24H17BrO4/c1-15-4-2-3-5-17(15)12-23-24(27)20-11-10-19(13-22(20)29-23)28-14-21(26)16-6-8-18(25)9-7-16/h2-13H,14H2,1H3/b23-12- |
| InChIKey | GGUOWMBOYREEKE-FMCGGJTJSA-N |
| XLogP | 5.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|