C25H17BrO6 — CID 19261163
methyl 4-[(Z)-[6-[2-(4-bromophenyl)-2-oxoethoxy]-3-oxo-1-benzofuran-2-ylidene]methyl]benzoate (PubChem CID 19261163) has the molecular formula C25H17BrO6 and a molecular weight of 493.31 g/mol. Its IUPAC name is methyl 4-[(Z)-[6-[2-(4-bromophenyl)-2-oxoethoxy]-3-oxo-1-benzofuran-2-ylidene]methyl]benzoate.
| Compound Name | methyl 4-[(Z)-[6-[2-(4-bromophenyl)-2-oxoethoxy]-3-oxo-1-benzofuran-2-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 19261163 |
| Molecular Formula | C25H17BrO6 |
| Molecular Weight | 493.31 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | methyl 4-[(Z)-[6-[2-(4-bromophenyl)-2-oxoethoxy]-3-oxo-1-benzofuran-2-ylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C2\Oc3cc(OCC(=O)c4ccc(Br)cc4)ccc3C2=O)cc1 |
| InChI | InChI=1S/C25H17BrO6/c1-30-25(29)17-4-2-15(3-5-17)12-23-24(28)20-11-10-19(13-22(20)32-23)31-14-21(27)16-6-8-18(26)9-7-16/h2-13H,14H2,1H3/b23-12- |
| InChIKey | DEHHMGKTBLSYEE-FMCGGJTJSA-N |
| XLogP | 5.11 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.31 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|