C26H21BrO4 — CID 5266294
6-[2-(4-bromophenyl)-2-oxoethoxy]-2-[(4-propan-2-ylphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 5266294) has the molecular formula C26H21BrO4 and a molecular weight of 477.35 g/mol. Its IUPAC name is 6-[2-(4-bromophenyl)-2-oxoethoxy]-2-[(4-propan-2-ylphenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | 6-[2-(4-bromophenyl)-2-oxoethoxy]-2-[(4-propan-2-ylphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 5266294 |
| Molecular Formula | C26H21BrO4 |
| Molecular Weight | 477.35 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 6-[2-(4-bromophenyl)-2-oxoethoxy]-2-[(4-propan-2-ylphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | CC(C)c1ccc(C=C2Oc3cc(OCC(=O)c4ccc(Br)cc4)ccc3C2=O)cc1 |
| InChI | InChI=1S/C26H21BrO4/c1-16(2)18-5-3-17(4-6-18)13-25-26(29)22-12-11-21(14-24(22)31-25)30-15-23(28)19-7-9-20(27)10-8-19/h3-14,16H,15H2,1-2H3 |
| InChIKey | ONIJMELYYICFPL-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.35 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|