C24H17FO4 — CID 5266143
6-[2-(4-fluorophenyl)-2-oxoethoxy]-2-[(4-methylphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 5266143) has the molecular formula C24H17FO4 and a molecular weight of 388.39 g/mol. Its IUPAC name is 6-[2-(4-fluorophenyl)-2-oxoethoxy]-2-[(4-methylphenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | 6-[2-(4-fluorophenyl)-2-oxoethoxy]-2-[(4-methylphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 5266143 |
| Molecular Formula | C24H17FO4 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 6-[2-(4-fluorophenyl)-2-oxoethoxy]-2-[(4-methylphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | Cc1ccc(C=C2Oc3cc(OCC(=O)c4ccc(F)cc4)ccc3C2=O)cc1 |
| InChI | InChI=1S/C24H17FO4/c1-15-2-4-16(5-3-15)12-23-24(27)20-11-10-19(13-22(20)29-23)28-14-21(26)17-6-8-18(25)9-7-17/h2-13H,14H2,1H3 |
| InChIKey | QIEIJVZHIXKXMV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|