C26H22O6 — CID 19261170
(2Z)-2-[(4-ethoxyphenyl)methylidene]-6-[2-(4-methoxyphenyl)-2-oxoethoxy]-1-benzofuran-3-one (PubChem CID 19261170) has the molecular formula C26H22O6 and a molecular weight of 430.46 g/mol. Its IUPAC name is (2Z)-2-[(4-ethoxyphenyl)methylidene]-6-[2-(4-methoxyphenyl)-2-oxoethoxy]-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(4-ethoxyphenyl)methylidene]-6-[2-(4-methoxyphenyl)-2-oxoethoxy]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 19261170 |
| Molecular Formula | C26H22O6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | (2Z)-2-[(4-ethoxyphenyl)methylidene]-6-[2-(4-methoxyphenyl)-2-oxoethoxy]-1-benzofuran-3-one |
| SMILES | CCOc1ccc(/C=C2\Oc3cc(OCC(=O)c4ccc(OC)cc4)ccc3C2=O)cc1 |
| InChI | InChI=1S/C26H22O6/c1-3-30-20-8-4-17(5-9-20)14-25-26(28)22-13-12-21(15-24(22)32-25)31-16-23(27)18-6-10-19(29-2)11-7-18/h4-15H,3,16H2,1-2H3/b25-14- |
| InChIKey | BZEQKJZWMVNJEM-QFEZKATASA-N |
| XLogP | 4.97 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|