C24H17BrO5 — CID 2018656
(2Z)-2-[(3-bromophenyl)methylidene]-6-[2-(4-methoxyphenyl)-2-oxoethoxy]-1-benzofuran-3-one (PubChem CID 2018656) has the molecular formula C24H17BrO5 and a molecular weight of 465.30 g/mol. Its IUPAC name is (2Z)-2-[(3-bromophenyl)methylidene]-6-[2-(4-methoxyphenyl)-2-oxoethoxy]-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(3-bromophenyl)methylidene]-6-[2-(4-methoxyphenyl)-2-oxoethoxy]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 2018656 |
| Molecular Formula | C24H17BrO5 |
| Molecular Weight | 465.30 g/mol |
| Exact Mass | 464.03 |
| IUPAC Name | (2Z)-2-[(3-bromophenyl)methylidene]-6-[2-(4-methoxyphenyl)-2-oxoethoxy]-1-benzofuran-3-one |
| SMILES | COc1ccc(C(=O)COc2ccc3c(c2)O/C(=C\c2cccc(Br)c2)C3=O)cc1 |
| InChI | InChI=1S/C24H17BrO5/c1-28-18-7-5-16(6-8-18)21(26)14-29-19-9-10-20-22(13-19)30-23(24(20)27)12-15-3-2-4-17(25)11-15/h2-13H,14H2,1H3/b23-12- |
| InChIKey | CONZYVLLFLULJS-FMCGGJTJSA-N |
| XLogP | 5.34 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.30 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|