C25H19ClO6 — CID 3785166
6-[2-(4-chlorophenyl)-2-oxoethoxy]-2-[(3,4-dimethoxyphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 3785166) has the molecular formula C25H19ClO6 and a molecular weight of 450.87 g/mol. Its IUPAC name is 6-[2-(4-chlorophenyl)-2-oxoethoxy]-2-[(3,4-dimethoxyphenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | 6-[2-(4-chlorophenyl)-2-oxoethoxy]-2-[(3,4-dimethoxyphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 3785166 |
| Molecular Formula | C25H19ClO6 |
| Molecular Weight | 450.87 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 6-[2-(4-chlorophenyl)-2-oxoethoxy]-2-[(3,4-dimethoxyphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | COc1ccc(C=C2Oc3cc(OCC(=O)c4ccc(Cl)cc4)ccc3C2=O)cc1OC |
| InChI | InChI=1S/C25H19ClO6/c1-29-21-10-3-15(11-23(21)30-2)12-24-25(28)19-9-8-18(13-22(19)32-24)31-14-20(27)16-4-6-17(26)7-5-16/h3-13H,14H2,1-2H3 |
| InChIKey | HGQHEIKZIVFXFK-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.87 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|