C23H17NO5 — CID 6220443
(2Z)-6-[2-(4-methoxyphenyl)-2-oxoethoxy]-2-(pyridin-4-ylmethylidene)-1-benzofuran-3-one (PubChem CID 6220443) has the molecular formula C23H17NO5 and a molecular weight of 387.39 g/mol. Its IUPAC name is (2Z)-6-[2-(4-methoxyphenyl)-2-oxoethoxy]-2-(pyridin-4-ylmethylidene)-1-benzofuran-3-one.
| Compound Name | (2Z)-6-[2-(4-methoxyphenyl)-2-oxoethoxy]-2-(pyridin-4-ylmethylidene)-1-benzofuran-3-one |
|---|---|
| PubChem CID | 6220443 |
| Molecular Formula | C23H17NO5 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | (2Z)-6-[2-(4-methoxyphenyl)-2-oxoethoxy]-2-(pyridin-4-ylmethylidene)-1-benzofuran-3-one |
| SMILES | COc1ccc(C(=O)COc2ccc3c(c2)O/C(=C\c2ccncc2)C3=O)cc1 |
| InChI | InChI=1S/C23H17NO5/c1-27-17-4-2-16(3-5-17)20(25)14-28-18-6-7-19-21(13-18)29-22(23(19)26)12-15-8-10-24-11-9-15/h2-13H,14H2,1H3/b22-12- |
| InChIKey | DRLFZHGMJDMIPL-UUYOSTAYSA-N |
| XLogP | 3.97 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|