C23H13Cl2FO4 — CID 5266176
2-[(2,4-dichlorophenyl)methylidene]-6-[2-(4-fluorophenyl)-2-oxoethoxy]-1-benzofuran-3-one (PubChem CID 5266176) has the molecular formula C23H13Cl2FO4 and a molecular weight of 443.26 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methylidene]-6-[2-(4-fluorophenyl)-2-oxoethoxy]-1-benzofuran-3-one.
| Compound Name | 2-[(2,4-dichlorophenyl)methylidene]-6-[2-(4-fluorophenyl)-2-oxoethoxy]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 5266176 |
| Molecular Formula | C23H13Cl2FO4 |
| Molecular Weight | 443.26 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methylidene]-6-[2-(4-fluorophenyl)-2-oxoethoxy]-1-benzofuran-3-one |
| SMILES | O=C(COc1ccc2c(c1)OC(=Cc1ccc(Cl)cc1Cl)C2=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H13Cl2FO4/c24-15-4-1-14(19(25)10-15)9-22-23(28)18-8-7-17(11-21(18)30-22)29-12-20(27)13-2-5-16(26)6-3-13/h1-11H,12H2 |
| InChIKey | DFHFINZEIUICKT-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.26 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|