C20H16Cl2O5 — CID 5266582
propan-2-yl 2-[[2-[(2,4-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetate (PubChem CID 5266582) has the molecular formula C20H16Cl2O5 and a molecular weight of 407.25 g/mol. Its IUPAC name is propan-2-yl 2-[[2-[(2,4-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetate.
| Compound Name | propan-2-yl 2-[[2-[(2,4-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 5266582 |
| Molecular Formula | C20H16Cl2O5 |
| Molecular Weight | 407.25 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | propan-2-yl 2-[[2-[(2,4-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetate |
| SMILES | CC(C)OC(=O)COc1ccc2c(c1)OC(=Cc1ccc(Cl)cc1Cl)C2=O |
| InChI | InChI=1S/C20H16Cl2O5/c1-11(2)26-19(23)10-25-14-5-6-15-17(9-14)27-18(20(15)24)7-12-3-4-13(21)8-16(12)22/h3-9,11H,10H2,1-2H3 |
| InChIKey | FJMYWTRGYDMMOX-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.25 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|