C20H17NO7 — CID 5266587
propan-2-yl 2-[[2-[(3-nitrophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetate (PubChem CID 5266587) has the molecular formula C20H17NO7 and a molecular weight of 383.36 g/mol. Its IUPAC name is propan-2-yl 2-[[2-[(3-nitrophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetate.
| Compound Name | propan-2-yl 2-[[2-[(3-nitrophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 5266587 |
| Molecular Formula | C20H17NO7 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | propan-2-yl 2-[[2-[(3-nitrophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetate |
| SMILES | CC(C)OC(=O)COc1ccc2c(c1)OC(=Cc1cccc([N+](=O)[O-])c1)C2=O |
| InChI | InChI=1S/C20H17NO7/c1-12(2)27-19(22)11-26-15-6-7-16-17(10-15)28-18(20(16)23)9-13-4-3-5-14(8-13)21(24)25/h3-10,12H,11H2,1-2H3 |
| InChIKey | IVTZIODPWDLUNC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|