C24H17NO8 — CID 5264811
[2-[(3-nitrophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 3,4-dimethoxybenzoate (PubChem CID 5264811) has the molecular formula C24H17NO8 and a molecular weight of 447.40 g/mol. Its IUPAC name is [2-[(3-nitrophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 3,4-dimethoxybenzoate.
| Compound Name | [2-[(3-nitrophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 5264811 |
| Molecular Formula | C24H17NO8 |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | [2-[(3-nitrophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc3c(c2)OC(=Cc2cccc([N+](=O)[O-])c2)C3=O)cc1OC |
| InChI | InChI=1S/C24H17NO8/c1-30-19-9-6-15(12-21(19)31-2)24(27)32-17-7-8-18-20(13-17)33-22(23(18)26)11-14-4-3-5-16(10-14)25(28)29/h3-13H,1-2H3 |
| InChIKey | WUSUPSIGJPQSDQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|