C26H22O7 — CID 18836008
[3-[(Z)-(6-ethoxy-3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] 3,4-dimethoxybenzoate (PubChem CID 18836008) has the molecular formula C26H22O7 and a molecular weight of 446.46 g/mol. Its IUPAC name is [3-[(Z)-(6-ethoxy-3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] 3,4-dimethoxybenzoate.
| Compound Name | [3-[(Z)-(6-ethoxy-3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 18836008 |
| Molecular Formula | C26H22O7 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | [3-[(Z)-(6-ethoxy-3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] 3,4-dimethoxybenzoate |
| SMILES | CCOc1ccc2c(c1)O/C(=C\c1cccc(OC(=O)c3ccc(OC)c(OC)c3)c1)C2=O |
| InChI | InChI=1S/C26H22O7/c1-4-31-18-9-10-20-22(15-18)33-24(25(20)27)13-16-6-5-7-19(12-16)32-26(28)17-8-11-21(29-2)23(14-17)30-3/h5-15H,4H2,1-3H3/b24-13- |
| InChIKey | GSTAGJIBQSFMEJ-CFRMEGHHSA-N |
| XLogP | 4.94 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|