About [2-ethoxy-6-[(Z)-(6-ethoxy-3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] 3-methoxybenzoate
[2-ethoxy-6-[(Z)-(6-ethoxy-3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] 3-methoxybenzoate (PubChem CID 18835957) has the molecular formula C27H24O7
and a molecular weight of 460.48 g/mol. Its IUPAC name is [2-ethoxy-6-[(Z)-(6-ethoxy-3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] 3-methoxybenzoate.
Molecular Properties
| Compound Name | [2-ethoxy-6-[(Z)-(6-ethoxy-3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] 3-methoxybenzoate |
| PubChem CID | 18835957 |
| Molecular Formula | C27H24O7 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | [2-ethoxy-6-[(Z)-(6-ethoxy-3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] 3-methoxybenzoate |
| SMILES | CCOc1ccc2c(c1)O/C(=C\c1cccc(OCC)c1OC(=O)c1cccc(OC)c1)C2=O |
| InChI | InChI=1S/C27H24O7/c1-4-31-20-12-13-21-23(16-20)33-24(25(21)28)15-17-8-7-11-22(32-5-2)26(17)34-27(29)18-9-6-10-19(14-18)30-3/h6-16H,4-5H2,1-3H3/b24-15- |
| InChIKey | BBTBJGTXFOXSSA-IWIPYMOSSA-N |
| XLogP | 5.33 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-ethoxy-6-[(Z)-(6-ethoxy-3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] 3-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-ethoxy-6-[(Z)-(6-ethoxy-3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] 3-methoxybenzoate?
The IUPAC name of [2-ethoxy-6-[(Z)-(6-ethoxy-3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] 3-methoxybenzoate (CID 18835957) is [2-ethoxy-6-[(Z)-(6-ethoxy-3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] 3-methoxybenzoate.
What is the SMILES notation for [2-ethoxy-6-[(Z)-(6-ethoxy-3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] 3-methoxybenzoate?
The canonical SMILES for [2-ethoxy-6-[(Z)-(6-ethoxy-3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] 3-methoxybenzoate is CCOc1ccc2c(c1)O/C(=C\c1cccc(OCC)c1OC(=O)c1cccc(OC)c1)C2=O.
What is the InChIKey of [2-ethoxy-6-[(Z)-(6-ethoxy-3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] 3-methoxybenzoate?
The InChIKey is BBTBJGTXFOXSSA-IWIPYMOSSA-N. The full InChI is InChI=1S/C27H24O7/c1-4-31-20-12-13-21-23(16-20)33-24(25(21)28)15-17-8-7-11-22(32-5-2)26(17)34-27(29)18-9-6-10-19(14-18)30-3/h6-16H,4-5H2,1-3H3/b24-15-.
What are the key properties of [2-ethoxy-6-[(Z)-(6-ethoxy-3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] 3-methoxybenzoate?
[2-ethoxy-6-[(Z)-(6-ethoxy-3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] 3-methoxybenzoate has a molecular weight of 460.48 g/mol, XLogP of 5.33, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-ethoxy-6-[(Z)-(6-ethoxy-3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] 3-methoxybenzoate is sourced from PubChem (CID 18835957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).