C25H19NO9 — CID 6535136
[(2Z)-3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 3-nitrobenzoate (PubChem CID 6535136) has the molecular formula C25H19NO9 and a molecular weight of 477.43 g/mol. Its IUPAC name is [(2Z)-3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 3-nitrobenzoate.
| Compound Name | [(2Z)-3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 6535136 |
| Molecular Formula | C25H19NO9 |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | [(2Z)-3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 3-nitrobenzoate |
| SMILES | COc1cc(OC)c(OC)cc1/C=C1\Oc2cc(OC(=O)c3cccc([N+](=O)[O-])c3)ccc2C1=O |
| InChI | InChI=1S/C25H19NO9/c1-31-19-13-22(33-3)21(32-2)10-15(19)11-23-24(27)18-8-7-17(12-20(18)35-23)34-25(28)14-5-4-6-16(9-14)26(29)30/h4-13H,1-3H3/b23-11- |
| InChIKey | UKULMCBCIMHWCR-KSEXSDGBSA-N |
| XLogP | 4.46 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|