C24H19NO8 — CID 163181360
3-[[2-[(2,4-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxycarbonyl]-N-hydroxybenzeneamine oxide (PubChem CID 163181360) has the molecular formula C24H19NO8 and a molecular weight of 449.42 g/mol. Its IUPAC name is 3-[[2-[(2,4-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxycarbonyl]-N-hydroxybenzeneamine oxide.
| Compound Name | 3-[[2-[(2,4-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxycarbonyl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163181360 |
| Molecular Formula | C24H19NO8 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 3-[[2-[(2,4-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxycarbonyl]-N-hydroxybenzeneamine oxide |
| SMILES | COc1ccc(C=C2Oc3cc(OC(=O)c4cccc([NH+]([O-])O)c4)ccc3C2=O)c(OC)c1 |
| InChI | InChI=1S/C24H19NO8/c1-30-17-7-6-14(20(12-17)31-2)11-22-23(26)19-9-8-18(13-21(19)33-22)32-24(27)15-4-3-5-16(10-15)25(28)29/h3-13,25,28H,1-2H3 |
| InChIKey | ZFRKXLUOIXQKDC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 118.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|