C22H20O7 — CID 110274925
[(2Z)-2-[(2,4-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] oxolane-2-carboxylate (PubChem CID 110274925) has the molecular formula C22H20O7 and a molecular weight of 396.40 g/mol. Its IUPAC name is [(2Z)-2-[(2,4-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] oxolane-2-carboxylate.
| Compound Name | [(2Z)-2-[(2,4-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] oxolane-2-carboxylate |
|---|---|
| PubChem CID | 110274925 |
| Molecular Formula | C22H20O7 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | [(2Z)-2-[(2,4-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] oxolane-2-carboxylate |
| SMILES | COc1ccc(/C=C2\Oc3cc(OC(=O)C4CCCO4)ccc3C2=O)c(OC)c1 |
| InChI | InChI=1S/C22H20O7/c1-25-14-6-5-13(18(11-14)26-2)10-20-21(23)16-8-7-15(12-19(16)29-20)28-22(24)17-4-3-9-27-17/h5-8,10-12,17H,3-4,9H2,1-2H3/b20-10- |
| InChIKey | LRJRPOZJKJEPKQ-JMIUGGIZSA-N |
| XLogP | 3.40 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|