C24H24O5 — CID 110274947
[(2Z)-2-[(4-tert-butylphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] oxolane-2-carboxylate (PubChem CID 110274947) has the molecular formula C24H24O5 and a molecular weight of 392.45 g/mol. Its IUPAC name is [(2Z)-2-[(4-tert-butylphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] oxolane-2-carboxylate.
| Compound Name | [(2Z)-2-[(4-tert-butylphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] oxolane-2-carboxylate |
|---|---|
| PubChem CID | 110274947 |
| Molecular Formula | C24H24O5 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | [(2Z)-2-[(4-tert-butylphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] oxolane-2-carboxylate |
| SMILES | CC(C)(C)c1ccc(/C=C2\Oc3cc(OC(=O)C4CCCO4)ccc3C2=O)cc1 |
| InChI | InChI=1S/C24H24O5/c1-24(2,3)16-8-6-15(7-9-16)13-21-22(25)18-11-10-17(14-20(18)29-21)28-23(26)19-5-4-12-27-19/h6-11,13-14,19H,4-5,12H2,1-3H3/b21-13- |
| InChIKey | KHGKJAFVOVVEEV-BKUYFWCQSA-N |
| XLogP | 4.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|