C27H22O5 — CID 110274900
[(2Z)-4-methyl-3-oxo-2-[(4-phenylphenyl)methylidene]-1-benzofuran-6-yl] oxolane-2-carboxylate (PubChem CID 110274900) has the molecular formula C27H22O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is [(2Z)-4-methyl-3-oxo-2-[(4-phenylphenyl)methylidene]-1-benzofuran-6-yl] oxolane-2-carboxylate.
| Compound Name | [(2Z)-4-methyl-3-oxo-2-[(4-phenylphenyl)methylidene]-1-benzofuran-6-yl] oxolane-2-carboxylate |
|---|---|
| PubChem CID | 110274900 |
| Molecular Formula | C27H22O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | [(2Z)-4-methyl-3-oxo-2-[(4-phenylphenyl)methylidene]-1-benzofuran-6-yl] oxolane-2-carboxylate |
| SMILES | Cc1cc(OC(=O)C2CCCO2)cc2c1C(=O)/C(=C/c1ccc(-c3ccccc3)cc1)O2 |
| InChI | InChI=1S/C27H22O5/c1-17-14-21(31-27(29)22-8-5-13-30-22)16-23-25(17)26(28)24(32-23)15-18-9-11-20(12-10-18)19-6-3-2-4-7-19/h2-4,6-7,9-12,14-16,22H,5,8,13H2,1H3/b24-15- |
| InChIKey | ZCESSXVGGMJDHQ-IWIPYMOSSA-N |
| XLogP | 5.36 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|