C28H27NO4 — CID 95022180
(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-4-methyl-6-phenacyloxy-1-benzofuran-3-one (PubChem CID 95022180) has the molecular formula C28H27NO4 and a molecular weight of 441.53 g/mol. Its IUPAC name is (2Z)-2-[[4-(diethylamino)phenyl]methylidene]-4-methyl-6-phenacyloxy-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[[4-(diethylamino)phenyl]methylidene]-4-methyl-6-phenacyloxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 95022180 |
| Molecular Formula | C28H27NO4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | (2Z)-2-[[4-(diethylamino)phenyl]methylidene]-4-methyl-6-phenacyloxy-1-benzofuran-3-one |
| SMILES | CCN(CC)c1ccc(/C=C2\Oc3cc(OCC(=O)c4ccccc4)cc(C)c3C2=O)cc1 |
| InChI | InChI=1S/C28H27NO4/c1-4-29(5-2)22-13-11-20(12-14-22)16-26-28(31)27-19(3)15-23(17-25(27)33-26)32-18-24(30)21-9-7-6-8-10-21/h6-17H,4-5,18H2,1-3H3/b26-16- |
| InChIKey | HORXZZIUSFHFTA-QQXSKIMKSA-N |
| XLogP | 5.72 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|