C30H27NO6 — CID 95021194
[(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 7-methoxy-1-benzofuran-2-carboxylate (PubChem CID 95021194) has the molecular formula C30H27NO6 and a molecular weight of 497.55 g/mol. Its IUPAC name is [(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 7-methoxy-1-benzofuran-2-carboxylate.
| Compound Name | [(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 7-methoxy-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 95021194 |
| Molecular Formula | C30H27NO6 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | [(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 7-methoxy-1-benzofuran-2-carboxylate |
| SMILES | CCN(CC)c1ccc(/C=C2\Oc3cc(OC(=O)c4cc5cccc(OC)c5o4)cc(C)c3C2=O)cc1 |
| InChI | InChI=1S/C30H27NO6/c1-5-31(6-2)21-12-10-19(11-13-21)15-25-28(32)27-18(3)14-22(17-24(27)36-25)35-30(33)26-16-20-8-7-9-23(34-4)29(20)37-26/h7-17H,5-6H2,1-4H3/b25-15- |
| InChIKey | QHZGJPGIMJARCR-MYYYXRDXSA-N |
| XLogP | 6.43 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|