C26H21BrO7 — CID 95397681
[(2Z)-4-methyl-3-oxo-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 4-bromobenzoate (PubChem CID 95397681) has the molecular formula C26H21BrO7 and a molecular weight of 525.35 g/mol. Its IUPAC name is [(2Z)-4-methyl-3-oxo-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 4-bromobenzoate.
| Compound Name | [(2Z)-4-methyl-3-oxo-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 4-bromobenzoate |
|---|---|
| PubChem CID | 95397681 |
| Molecular Formula | C26H21BrO7 |
| Molecular Weight | 525.35 g/mol |
| Exact Mass | 524.05 |
| IUPAC Name | [(2Z)-4-methyl-3-oxo-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 4-bromobenzoate |
| SMILES | COc1cc(/C=C2\Oc3cc(OC(=O)c4ccc(Br)cc4)cc(C)c3C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C26H21BrO7/c1-14-9-18(33-26(29)16-5-7-17(27)8-6-16)13-19-23(14)24(28)20(34-19)10-15-11-21(30-2)25(32-4)22(12-15)31-3/h5-13H,1-4H3/b20-10- |
| InChIKey | PHFVZJKPVGQRJV-JMIUGGIZSA-N |
| XLogP | 5.62 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.35 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|