C26H21ClO6 — CID 110274265
[(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 2-chloro-2-phenylacetate (PubChem CID 110274265) has the molecular formula C26H21ClO6 and a molecular weight of 464.90 g/mol. Its IUPAC name is [(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 2-chloro-2-phenylacetate.
| Compound Name | [(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 2-chloro-2-phenylacetate |
|---|---|
| PubChem CID | 110274265 |
| Molecular Formula | C26H21ClO6 |
| Molecular Weight | 464.90 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | [(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 2-chloro-2-phenylacetate |
| SMILES | COc1ccc(/C=C2\Oc3cc(OC(=O)C(Cl)c4ccccc4)cc(C)c3C2=O)cc1OC |
| InChI | InChI=1S/C26H21ClO6/c1-15-11-18(32-26(29)24(27)17-7-5-4-6-8-17)14-21-23(15)25(28)22(33-21)13-16-9-10-19(30-2)20(12-16)31-3/h4-14,24H,1-3H3/b22-13- |
| InChIKey | MDVKTIKKZWTBPJ-XKZIYDEJSA-N |
| XLogP | 5.51 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.90 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|